C14H16N6O2S — CID 118411286
1-[3-ethyl-2-[(1-hydroxypyrazol-3-yl)sulfanylmethyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 118411286) has the molecular formula C14H16N6O2S and a molecular weight of 332.39 g/mol. Its IUPAC name is 1-[3-ethyl-2-[(1-hydroxypyrazol-3-yl)sulfanylmethyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-ethyl-2-[(1-hydroxypyrazol-3-yl)sulfanylmethyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118411286 |
| Molecular Formula | C14H16N6O2S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-[3-ethyl-2-[(1-hydroxypyrazol-3-yl)sulfanylmethyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | CCc1cccc(-n2nnn(C)c2=O)c1CSc1ccn(O)n1 |
| InChI | InChI=1S/C14H16N6O2S/c1-3-10-5-4-6-12(20-14(21)18(2)16-17-20)11(10)9-23-13-7-8-19(22)15-13/h4-8,22H,3,9H2,1-2H3 |
| InChIKey | RZSTXVMDBHHZLE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|