C12H11FN6O2S — CID 126515887
1-[3-fluoro-2-[(1-hydroxypyrazol-3-yl)sulfanylmethyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 126515887) has the molecular formula C12H11FN6O2S and a molecular weight of 322.33 g/mol. Its IUPAC name is 1-[3-fluoro-2-[(1-hydroxypyrazol-3-yl)sulfanylmethyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-fluoro-2-[(1-hydroxypyrazol-3-yl)sulfanylmethyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 126515887 |
| Molecular Formula | C12H11FN6O2S |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-[3-fluoro-2-[(1-hydroxypyrazol-3-yl)sulfanylmethyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | Cn1nnn(-c2cccc(F)c2CSc2ccn(O)n2)c1=O |
| InChI | InChI=1S/C12H11FN6O2S/c1-17-12(20)19(16-15-17)10-4-2-3-9(13)8(10)7-22-11-5-6-18(21)14-11/h2-6,21H,7H2,1H3 |
| InChIKey | BYBHAFQPXZEZJF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|