C13H17N5OS — CID 159164165
[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-methylethanimidothioate (PubChem CID 159164165) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-methylethanimidothioate.
| Compound Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-methylethanimidothioate |
|---|---|
| PubChem CID | 159164165 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-methylethanimidothioate |
| SMILES | C/N=C(\C)SCc1c(C)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C13H17N5OS/c1-9-6-5-7-12(11(9)8-20-10(2)14-3)18-13(19)17(4)15-16-18/h5-7H,8H2,1-4H3/b14-10+ |
| InChIKey | KKWBMYVKHNGQMO-GXDHUFHOSA-N |
| XLogP | 1.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|