C12H14N6O2S — CID 166942356
[2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-formamidomethanimidothioate (PubChem CID 166942356) has the molecular formula C12H14N6O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-formamidomethanimidothioate.
| Compound Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-formamidomethanimidothioate |
|---|---|
| PubChem CID | 166942356 |
| Molecular Formula | C12H14N6O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [2-methyl-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methyl N-formamidomethanimidothioate |
| SMILES | Cc1cccc(-n2nnn(C)c2=O)c1CSC=NNC=O |
| InChI | InChI=1S/C12H14N6O2S/c1-9-4-3-5-11(18-12(20)17(2)15-16-18)10(9)6-21-8-14-13-7-19/h3-5,7-8H,6H2,1-2H3,(H,13,19) |
| InChIKey | XTCSGRHNOZCYCL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|