C18H22N2O4 — CID 118411498
tert-butyl N-[5,6-bis(hydroxymethyl)-2-phenyl-3-pyridinyl]carbamate (PubChem CID 118411498) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is tert-butyl N-[5,6-bis(hydroxymethyl)-2-phenyl-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5,6-bis(hydroxymethyl)-2-phenyl-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 118411498 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | tert-butyl N-[5,6-bis(hydroxymethyl)-2-phenyl-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CO)c(CO)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c1-18(2,3)24-17(23)20-14-9-13(10-21)15(11-22)19-16(14)12-7-5-4-6-8-12/h4-9,21-22H,10-11H2,1-3H3,(H,20,23) |
| InChIKey | VHIXNEIBTPVTRV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |