C21H18F3N3O3 — CID 118413553
6-(2,6-difluorophenyl)-5-fluoro-N-[4-(4-hydroxybutoxy)-3-pyridinyl]pyridine-2-carboxamide (PubChem CID 118413553) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-5-fluoro-N-[4-(4-hydroxybutoxy)-3-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 6-(2,6-difluorophenyl)-5-fluoro-N-[4-(4-hydroxybutoxy)-3-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118413553 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 6-(2,6-difluorophenyl)-5-fluoro-N-[4-(4-hydroxybutoxy)-3-pyridinyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cnccc1OCCCCO)c1ccc(F)c(-c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C21H18F3N3O3/c22-13-4-3-5-14(23)19(13)20-15(24)6-7-16(26-20)21(29)27-17-12-25-9-8-18(17)30-11-2-1-10-28/h3-9,12,28H,1-2,10-11H2,(H,27,29) |
| InChIKey | BCLYMVPOBBAPJN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|