About 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide
6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide (PubChem CID 118414266) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide |
| PubChem CID | 118414266 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide |
| SMILES | Cc1noc(C)c1Cn1ccc2cc(-c3cccc(C(N)=O)n3)ccc21 |
| InChI | InChI=1S/C20H18N4O2/c1-12-16(13(2)26-23-12)11-24-9-8-15-10-14(6-7-19(15)24)17-4-3-5-18(22-17)20(21)25/h3-10H,11H2,1-2H3,(H2,21,25) |
| InChIKey | QCDGOCYTJGWBKS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide?
The IUPAC name of 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide (CID 118414266) is 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide.
What is the SMILES notation for 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide?
The canonical SMILES for 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide is Cc1noc(C)c1Cn1ccc2cc(-c3cccc(C(N)=O)n3)ccc21.
What is the InChIKey of 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide?
The InChIKey is QCDGOCYTJGWBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c1-12-16(13(2)26-23-12)11-24-9-8-15-10-14(6-7-19(15)24)17-4-3-5-18(22-17)20(21)25/h3-10H,11H2,1-2H3,(H2,21,25).
What are the key properties of 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide?
6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide has a molecular weight of 346.39 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]indol-5-yl]pyridine-2-carboxamide is sourced from PubChem (CID 118414266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).