C28H36FN5O — CID 118416681
2-butyl-7-[6-(3-fluoropyrrolidin-1-yl)hex-1-ynyl]-5-(phenylmethoxymethyl)pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 118416681) has the molecular formula C28H36FN5O and a molecular weight of 477.63 g/mol. Its IUPAC name is 2-butyl-7-[6-(3-fluoropyrrolidin-1-yl)hex-1-ynyl]-5-(phenylmethoxymethyl)pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-butyl-7-[6-(3-fluoropyrrolidin-1-yl)hex-1-ynyl]-5-(phenylmethoxymethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118416681 |
| Molecular Formula | C28H36FN5O |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 2-butyl-7-[6-(3-fluoropyrrolidin-1-yl)hex-1-ynyl]-5-(phenylmethoxymethyl)pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CCCCc1nc(N)c2c(n1)c(C#CCCCCN1CCC(F)C1)cn2COCc1ccccc1 |
| InChI | InChI=1S/C28H36FN5O/c1-2-3-14-25-31-26-23(13-9-4-5-10-16-33-17-15-24(29)19-33)18-34(27(26)28(30)32-25)21-35-20-22-11-7-6-8-12-22/h6-8,11-12,18,24H,2-5,10,14-17,19-21H2,1H3,(H2,30,31,32) |
| InChIKey | KVLVZVPTZZQEQO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|