C20H32FN5 — CID 74767477
2-butyl-7-[5-[(3R)-3-fluoropyrrolidin-1-yl]pentyl]-6-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 74767477) has the molecular formula C20H32FN5 and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-butyl-7-[5-[(3R)-3-fluoropyrrolidin-1-yl]pentyl]-6-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-butyl-7-[5-[(3R)-3-fluoropyrrolidin-1-yl]pentyl]-6-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 74767477 |
| Molecular Formula | C20H32FN5 |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 2-butyl-7-[5-[(3R)-3-fluoropyrrolidin-1-yl]pentyl]-6-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CCCCc1nc(N)c2[nH]c(C)c(CCCCCN3CC[C@@H](F)C3)c2n1 |
| InChI | InChI=1S/C20H32FN5/c1-3-4-9-17-24-18-16(14(2)23-19(18)20(22)25-17)8-6-5-7-11-26-12-10-15(21)13-26/h15,23H,3-13H2,1-2H3,(H2,22,24,25)/t15-/m1/s1 |
| InChIKey | KRSBEXDSLZJPCB-OAHLLOKOSA-N |
| XLogP | 3.95 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|