C19H31N5O2 — CID 118336082
(3R,5R)-1-[6-(4-amino-2,6-dimethyl-5H-pyrrolo[3,2-d]pyrimidin-7-yl)hexyl]piperidine-3,5-diol (PubChem CID 118336082) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (3R,5R)-1-[6-(4-amino-2,6-dimethyl-5H-pyrrolo[3,2-d]pyrimidin-7-yl)hexyl]piperidine-3,5-diol.
| Compound Name | (3R,5R)-1-[6-(4-amino-2,6-dimethyl-5H-pyrrolo[3,2-d]pyrimidin-7-yl)hexyl]piperidine-3,5-diol |
|---|---|
| PubChem CID | 118336082 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (3R,5R)-1-[6-(4-amino-2,6-dimethyl-5H-pyrrolo[3,2-d]pyrimidin-7-yl)hexyl]piperidine-3,5-diol |
| SMILES | Cc1nc(N)c2[nH]c(C)c(CCCCCCN3C[C@H](O)C[C@@H](O)C3)c2n1 |
| InChI | InChI=1S/C19H31N5O2/c1-12-16(17-18(21-12)19(20)23-13(2)22-17)7-5-3-4-6-8-24-10-14(25)9-15(26)11-24/h14-15,21,25-26H,3-11H2,1-2H3,(H2,20,22,23)/t14-,15-/m1/s1 |
| InChIKey | KTCSHAHEZVEULG-HUUCEWRRSA-N |
| XLogP | 1.69 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|