C13H20N6O — CID 90924967
6-amino-2-methyl-9-[(3-methylpiperidin-1-yl)methyl]-7H-purin-8-one (PubChem CID 90924967) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-amino-2-methyl-9-[(3-methylpiperidin-1-yl)methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-methyl-9-[(3-methylpiperidin-1-yl)methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 90924967 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 6-amino-2-methyl-9-[(3-methylpiperidin-1-yl)methyl]-7H-purin-8-one |
| SMILES | Cc1nc(N)c2[nH]c(=O)n(CN3CCCC(C)C3)c2n1 |
| InChI | InChI=1S/C13H20N6O/c1-8-4-3-5-18(6-8)7-19-12-10(17-13(19)20)11(14)15-9(2)16-12/h8H,3-7H2,1-2H3,(H,17,20)(H2,14,15,16) |
| InChIKey | KEMAIAJJENORDE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |