C26H29N5O2 — CID 159992710
6-amino-9-[[3-[3-(cyclohexylmethyl)phenoxy]phenyl]methyl]-2-methyl-7H-purin-8-one (PubChem CID 159992710) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 6-amino-9-[[3-[3-(cyclohexylmethyl)phenoxy]phenyl]methyl]-2-methyl-7H-purin-8-one.
| Compound Name | 6-amino-9-[[3-[3-(cyclohexylmethyl)phenoxy]phenyl]methyl]-2-methyl-7H-purin-8-one |
|---|---|
| PubChem CID | 159992710 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 6-amino-9-[[3-[3-(cyclohexylmethyl)phenoxy]phenyl]methyl]-2-methyl-7H-purin-8-one |
| SMILES | Cc1nc(N)c2[nH]c(=O)n(Cc3cccc(Oc4cccc(CC5CCCCC5)c4)c3)c2n1 |
| InChI | InChI=1S/C26H29N5O2/c1-17-28-24(27)23-25(29-17)31(26(32)30-23)16-20-10-6-12-22(15-20)33-21-11-5-9-19(14-21)13-18-7-3-2-4-8-18/h5-6,9-12,14-15,18H,2-4,7-8,13,16H2,1H3,(H,30,32)(H2,27,28,29) |
| InChIKey | JJEBGHKQQKIBAX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |