C23H26N6O2 — CID 159913053
6-amino-2-methyl-9-[[6-[4-(3-methylbutyl)phenoxy]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 159913053) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 6-amino-2-methyl-9-[[6-[4-(3-methylbutyl)phenoxy]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-methyl-9-[[6-[4-(3-methylbutyl)phenoxy]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 159913053 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 6-amino-2-methyl-9-[[6-[4-(3-methylbutyl)phenoxy]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | Cc1nc(N)c2[nH]c(=O)n(Cc3ccc(Oc4ccc(CCC(C)C)cc4)nc3)c2n1 |
| InChI | InChI=1S/C23H26N6O2/c1-14(2)4-5-16-6-9-18(10-7-16)31-19-11-8-17(12-25-19)13-29-22-20(28-23(29)30)21(24)26-15(3)27-22/h6-12,14H,4-5,13H2,1-3H3,(H,28,30)(H2,24,26,27) |
| InChIKey | ZIKSYMLXPLQHDN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |