C24H26FN5O2 — CID 158747086
6-amino-9-[[3-fluoro-4-(4-pentylphenoxy)phenyl]methyl]-2-methyl-7H-purin-8-one (PubChem CID 158747086) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 6-amino-9-[[3-fluoro-4-(4-pentylphenoxy)phenyl]methyl]-2-methyl-7H-purin-8-one.
| Compound Name | 6-amino-9-[[3-fluoro-4-(4-pentylphenoxy)phenyl]methyl]-2-methyl-7H-purin-8-one |
|---|---|
| PubChem CID | 158747086 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 6-amino-9-[[3-fluoro-4-(4-pentylphenoxy)phenyl]methyl]-2-methyl-7H-purin-8-one |
| SMILES | CCCCCc1ccc(Oc2ccc(Cn3c(=O)[nH]c4c(N)nc(C)nc43)cc2F)cc1 |
| InChI | InChI=1S/C24H26FN5O2/c1-3-4-5-6-16-7-10-18(11-8-16)32-20-12-9-17(13-19(20)25)14-30-23-21(29-24(30)31)22(26)27-15(2)28-23/h7-13H,3-6,14H2,1-2H3,(H,29,31)(H2,26,27,28) |
| InChIKey | KVJCSGDMLWHHKW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|