C26H29N5O3 — CID 158101687
6-amino-2-methyl-9-[[3-[3-[2-(oxan-4-yl)ethyl]phenoxy]phenyl]methyl]-7H-purin-8-one (PubChem CID 158101687) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is 6-amino-2-methyl-9-[[3-[3-[2-(oxan-4-yl)ethyl]phenoxy]phenyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-methyl-9-[[3-[3-[2-(oxan-4-yl)ethyl]phenoxy]phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 158101687 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 6-amino-2-methyl-9-[[3-[3-[2-(oxan-4-yl)ethyl]phenoxy]phenyl]methyl]-7H-purin-8-one |
| SMILES | Cc1nc(N)c2[nH]c(=O)n(Cc3cccc(Oc4cccc(CCC5CCOCC5)c4)c3)c2n1 |
| InChI | InChI=1S/C26H29N5O3/c1-17-28-24(27)23-25(29-17)31(26(32)30-23)16-20-5-3-7-22(15-20)34-21-6-2-4-19(14-21)9-8-18-10-12-33-13-11-18/h2-7,14-15,18H,8-13,16H2,1H3,(H,30,32)(H2,27,28,29) |
| InChIKey | XZTMSEQXTKRSKT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |