C17H23N3O3 — CID 118417587
2-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)butanoic acid (PubChem CID 118417587) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)butanoic acid.
| Compound Name | 2-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)butanoic acid |
|---|---|
| PubChem CID | 118417587 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)butanoic acid |
| SMILES | CCC(C(=O)O)N1CN(c2ccccc2)C2(CCNCC2)C1=O |
| InChI | InChI=1S/C17H23N3O3/c1-2-14(15(21)22)19-12-20(13-6-4-3-5-7-13)17(16(19)23)8-10-18-11-9-17/h3-7,14,18H,2,8-12H2,1H3,(H,21,22) |
| InChIKey | HLKQBVMPMOQZQV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |