C17H23N3O — CID 54506307
3-but-2-enyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 54506307) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-but-2-enyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 3-but-2-enyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 54506307 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3-but-2-enyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CC=CCN1CN(c2ccccc2)C2(CCNCC2)C1=O |
| InChI | InChI=1S/C17H23N3O/c1-2-3-13-19-14-20(15-7-5-4-6-8-15)17(16(19)21)9-11-18-12-10-17/h2-8,18H,9-14H2,1H3 |
| InChIKey | YFYNWPVSBXAULA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|