C10H4ClF8N3S — CID 118418746
2-chloro-4-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,3-thiazole (PubChem CID 118418746) has the molecular formula C10H4ClF8N3S and a molecular weight of 385.67 g/mol. Its IUPAC name is 2-chloro-4-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,3-thiazole.
| Compound Name | 2-chloro-4-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 118418746 |
| Molecular Formula | C10H4ClF8N3S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 2-chloro-4-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]-1,3-thiazole |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-c1csc(Cl)n1 |
| InChI | InChI=1S/C10H4ClF8N3S/c1-22-5(3-2-23-7(11)20-3)4(9(14,15)16)6(21-22)8(12,13)10(17,18)19/h2H,1H3 |
| InChIKey | IJBCLKKDWKFZNH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|