C21H23ClFN3O — CID 118419718
(2S)-1-[[2-chloro-6-(7-fluoroquinolin-4-yl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine (PubChem CID 118419718) has the molecular formula C21H23ClFN3O and a molecular weight of 387.89 g/mol. Its IUPAC name is (2S)-1-[[2-chloro-6-(7-fluoroquinolin-4-yl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine.
| Compound Name | (2S)-1-[[2-chloro-6-(7-fluoroquinolin-4-yl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 118419718 |
| Molecular Formula | C21H23ClFN3O |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2S)-1-[[2-chloro-6-(7-fluoroquinolin-4-yl)-3-pyridinyl]oxy]-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)C[C@](C)(N)COc1ccc(-c2ccnc3cc(F)ccc23)nc1Cl |
| InChI | InChI=1S/C21H23ClFN3O/c1-13(2)11-21(3,24)12-27-19-7-6-17(26-20(19)22)16-8-9-25-18-10-14(23)4-5-15(16)18/h4-10,13H,11-12,24H2,1-3H3/t21-/m0/s1 |
| InChIKey | DFOZFPXLACXZBX-NRFANRHFSA-N |
| XLogP | 5.23 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|