C21H23ClN2O — CID 118429692
4-[6-chloro-5-[(2R)-2,4-dimethylpentoxy]-2-pyridinyl]quinoline (PubChem CID 118429692) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 4-[6-chloro-5-[(2R)-2,4-dimethylpentoxy]-2-pyridinyl]quinoline.
| Compound Name | 4-[6-chloro-5-[(2R)-2,4-dimethylpentoxy]-2-pyridinyl]quinoline |
|---|---|
| PubChem CID | 118429692 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-[6-chloro-5-[(2R)-2,4-dimethylpentoxy]-2-pyridinyl]quinoline |
| SMILES | CC(C)C[C@@H](C)COc1ccc(-c2ccnc3ccccc23)nc1Cl |
| InChI | InChI=1S/C21H23ClN2O/c1-14(2)12-15(3)13-25-20-9-8-19(24-21(20)22)17-10-11-23-18-7-5-4-6-16(17)18/h4-11,14-15H,12-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | IDNBPHLKIVXSLB-OAHLLOKOSA-N |
| XLogP | 6.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|