C18H21ClF2N2O — CID 144939984
6-(2-chloro-4-pyridinyl)-2-(difluoromethyl)-3-(2,4-dimethylpentoxy)pyridine (PubChem CID 144939984) has the molecular formula C18H21ClF2N2O and a molecular weight of 354.83 g/mol. Its IUPAC name is 6-(2-chloro-4-pyridinyl)-2-(difluoromethyl)-3-(2,4-dimethylpentoxy)pyridine.
| Compound Name | 6-(2-chloro-4-pyridinyl)-2-(difluoromethyl)-3-(2,4-dimethylpentoxy)pyridine |
|---|---|
| PubChem CID | 144939984 |
| Molecular Formula | C18H21ClF2N2O |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 6-(2-chloro-4-pyridinyl)-2-(difluoromethyl)-3-(2,4-dimethylpentoxy)pyridine |
| SMILES | CC(C)CC(C)COc1ccc(-c2ccnc(Cl)c2)nc1C(F)F |
| InChI | InChI=1S/C18H21ClF2N2O/c1-11(2)8-12(3)10-24-15-5-4-14(23-17(15)18(20)21)13-6-7-22-16(19)9-13/h4-7,9,11-12,18H,8,10H2,1-3H3 |
| InChIKey | HFXIYBRBSDPEAU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|