About 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline
6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline (PubChem CID 157136865) has the molecular formula C22H25ClN2O
and a molecular weight of 368.91 g/mol. Its IUPAC name is 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline.
Molecular Properties
| Compound Name | 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline |
| PubChem CID | 157136865 |
| Molecular Formula | C22H25ClN2O |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline |
| SMILES | Cc1cc(-c2ccnc3ccc(Cl)cc23)ncc1OC[C@@H](C)CC(C)C |
| InChI | InChI=1S/C22H25ClN2O/c1-14(2)9-15(3)13-26-22-12-25-21(10-16(22)4)18-7-8-24-20-6-5-17(23)11-19(18)20/h5-8,10-12,14-15H,9,13H2,1-4H3/t15-/m0/s1 |
| InChIKey | AJSLVQIEQUXUSM-HNNXBMFYSA-N |
| XLogP | 6.32 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline?
The IUPAC name of 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline (CID 157136865) is 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline.
What is the SMILES notation for 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline?
The canonical SMILES for 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline is Cc1cc(-c2ccnc3ccc(Cl)cc23)ncc1OC[C@@H](C)CC(C)C.
What is the InChIKey of 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline?
The InChIKey is AJSLVQIEQUXUSM-HNNXBMFYSA-N. The full InChI is InChI=1S/C22H25ClN2O/c1-14(2)9-15(3)13-26-22-12-25-21(10-16(22)4)18-7-8-24-20-6-5-17(23)11-19(18)20/h5-8,10-12,14-15H,9,13H2,1-4H3/t15-/m0/s1.
What are the key properties of 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline?
6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline has a molecular weight of 368.91 g/mol, XLogP of 6.32, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-[5-[(2S)-2,4-dimethylpentoxy]-4-methyl-2-pyridinyl]quinoline is sourced from PubChem (CID 157136865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).