C19H22ClN3O — CID 145286186
4-[3-chloro-4-(2,4-dimethylpentoxy)phenyl]-1H-pyrazolo[3,4-b]pyridine (PubChem CID 145286186) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is 4-[3-chloro-4-(2,4-dimethylpentoxy)phenyl]-1H-pyrazolo[3,4-b]pyridine.
| Compound Name | 4-[3-chloro-4-(2,4-dimethylpentoxy)phenyl]-1H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 145286186 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-[3-chloro-4-(2,4-dimethylpentoxy)phenyl]-1H-pyrazolo[3,4-b]pyridine |
| SMILES | CC(C)CC(C)COc1ccc(-c2ccnc3[nH]ncc23)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O/c1-12(2)8-13(3)11-24-18-5-4-14(9-17(18)20)15-6-7-21-19-16(15)10-22-23-19/h4-7,9-10,12-13H,8,11H2,1-3H3,(H,21,22,23) |
| InChIKey | DJIHZYXGHSBUOK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |