C19H20ClF4NO — CID 152541991
5-chloro-4-[4-[(2S)-2,4-dimethylpentoxy]-3-(trifluoromethyl)phenyl]-2-fluoropyridine (PubChem CID 152541991) has the molecular formula C19H20ClF4NO and a molecular weight of 389.82 g/mol. Its IUPAC name is 5-chloro-4-[4-[(2S)-2,4-dimethylpentoxy]-3-(trifluoromethyl)phenyl]-2-fluoropyridine.
| Compound Name | 5-chloro-4-[4-[(2S)-2,4-dimethylpentoxy]-3-(trifluoromethyl)phenyl]-2-fluoropyridine |
|---|---|
| PubChem CID | 152541991 |
| Molecular Formula | C19H20ClF4NO |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 5-chloro-4-[4-[(2S)-2,4-dimethylpentoxy]-3-(trifluoromethyl)phenyl]-2-fluoropyridine |
| SMILES | CC(C)C[C@H](C)COc1ccc(-c2cc(F)ncc2Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C19H20ClF4NO/c1-11(2)6-12(3)10-26-17-5-4-13(7-15(17)19(22,23)24)14-8-18(21)25-9-16(14)20/h4-5,7-9,11-12H,6,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | YLSQDASXUDXCSP-LBPRGKRZSA-N |
| XLogP | 6.62 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|