C19H21ClF4N2O — CID 135282218
(4S)-5-[4-(5-chloro-2-fluoro-4-pyridinyl)-2-(trifluoromethyl)phenoxy]-2,4-dimethylpentan-2-amine (PubChem CID 135282218) has the molecular formula C19H21ClF4N2O and a molecular weight of 404.84 g/mol. Its IUPAC name is (4S)-5-[4-(5-chloro-2-fluoro-4-pyridinyl)-2-(trifluoromethyl)phenoxy]-2,4-dimethylpentan-2-amine.
| Compound Name | (4S)-5-[4-(5-chloro-2-fluoro-4-pyridinyl)-2-(trifluoromethyl)phenoxy]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 135282218 |
| Molecular Formula | C19H21ClF4N2O |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (4S)-5-[4-(5-chloro-2-fluoro-4-pyridinyl)-2-(trifluoromethyl)phenoxy]-2,4-dimethylpentan-2-amine |
| SMILES | C[C@H](COc1ccc(-c2cc(F)ncc2Cl)cc1C(F)(F)F)CC(C)(C)N |
| InChI | InChI=1S/C19H21ClF4N2O/c1-11(8-18(2,3)25)10-27-16-5-4-12(6-14(16)19(22,23)24)13-7-17(21)26-9-15(13)20/h4-7,9,11H,8,10,25H2,1-3H3/t11-/m0/s1 |
| InChIKey | OTBCOUCKHWOQJB-NSHDSACASA-N |
| XLogP | 5.70 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|