C21H23ClN2O — CID 151386101
4-[4-chloro-5-[(2S)-2,4-dimethylpentoxy]-2-pyridinyl]quinoline (PubChem CID 151386101) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 4-[4-chloro-5-[(2S)-2,4-dimethylpentoxy]-2-pyridinyl]quinoline.
| Compound Name | 4-[4-chloro-5-[(2S)-2,4-dimethylpentoxy]-2-pyridinyl]quinoline |
|---|---|
| PubChem CID | 151386101 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-[4-chloro-5-[(2S)-2,4-dimethylpentoxy]-2-pyridinyl]quinoline |
| SMILES | CC(C)C[C@H](C)COc1cnc(-c2ccnc3ccccc23)cc1Cl |
| InChI | InChI=1S/C21H23ClN2O/c1-14(2)10-15(3)13-25-21-12-24-20(11-18(21)22)17-8-9-23-19-7-5-4-6-16(17)19/h4-9,11-12,14-15H,10,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | OTKZAWWUKAIBRG-HNNXBMFYSA-N |
| XLogP | 6.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |