C19H24ClN3O3 — CID 118420360
[4-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]-2-pyridinyl] carbamate (PubChem CID 118420360) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is [4-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]-2-pyridinyl] carbamate.
| Compound Name | [4-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]-2-pyridinyl] carbamate |
|---|---|
| PubChem CID | 118420360 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [4-[4-(2-amino-2,4-dimethylpentoxy)-3-chlorophenyl]-2-pyridinyl] carbamate |
| SMILES | CC(C)CC(C)(N)COc1ccc(-c2ccnc(OC(N)=O)c2)cc1Cl |
| InChI | InChI=1S/C19H24ClN3O3/c1-12(2)10-19(3,22)11-25-16-5-4-13(8-15(16)20)14-6-7-23-17(9-14)26-18(21)24/h4-9,12H,10-11,22H2,1-3H3,(H2,21,24) |
| InChIKey | FZGACBOTKVLVSN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |