C17H22ClN3O — CID 150312529
1-(2-chloro-4-pyridazin-4-ylphenoxy)-2,4-dimethylpentan-2-amine (PubChem CID 150312529) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridazin-4-ylphenoxy)-2,4-dimethylpentan-2-amine.
| Compound Name | 1-(2-chloro-4-pyridazin-4-ylphenoxy)-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 150312529 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-(2-chloro-4-pyridazin-4-ylphenoxy)-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)CC(C)(N)COc1ccc(-c2ccnnc2)cc1Cl |
| InChI | InChI=1S/C17H22ClN3O/c1-12(2)9-17(3,19)11-22-16-5-4-13(8-15(16)18)14-6-7-20-21-10-14/h4-8,10,12H,9,11,19H2,1-3H3 |
| InChIKey | GLXVPMDYJHKUTE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |