C16H11NO2 — CID 11842096
2-benzylidene-4-phenyl-1,3-oxazol-5-one (PubChem CID 11842096) has the molecular formula C16H11NO2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-benzylidene-4-phenyl-1,3-oxazol-5-one.
| Compound Name | 2-benzylidene-4-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 11842096 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-benzylidene-4-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(=Cc2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C16H11NO2/c18-16-15(13-9-5-2-6-10-13)17-14(19-16)11-12-7-3-1-4-8-12/h1-11H |
| InChIKey | LDVFFQFWQPYFSE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |