About 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate
2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate (PubChem CID 11782798) has the molecular formula C22H15NO3
and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate.
Molecular Properties
| Compound Name | 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate |
| PubChem CID | 11782798 |
| Molecular Formula | C22H15NO3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate |
| SMILES | O=C1O[N+](=C(c2ccccc2)c2ccccc2)C([O-])=C1c1ccccc1 |
| InChI | InChI=1S/C22H15NO3/c24-21-19(16-10-4-1-5-11-16)22(25)26-23(21)20(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | VODPGZXOAFTESM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate?
The IUPAC name of 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate (CID 11782798) is 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate.
What is the SMILES notation for 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate?
The canonical SMILES for 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate is O=C1O[N+](=C(c2ccccc2)c2ccccc2)C([O-])=C1c1ccccc1.
What is the InChIKey of 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate?
The InChIKey is VODPGZXOAFTESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO3/c24-21-19(16-10-4-1-5-11-16)22(25)26-23(21)20(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H.
What are the key properties of 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate?
2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate has a molecular weight of 341.37 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydrylidene-5-oxo-4-phenyl-1,2-oxazol-2-ium-3-olate is sourced from PubChem (CID 11782798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).