C15H11NO2 — CID 12486396
3,4-diphenyl-5(4H)-isoxazolone (PubChem CID 12486396) has the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. Its IUPAC name is 3,4-diphenyl-4H-1,2-oxazol-5-one.
| Compound Name | 3,4-diphenyl-5(4H)-isoxazolone |
|---|---|
| PubChem CID | 12486396 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 3,4-diphenyl-4H-1,2-oxazol-5-one |
| SMILES | C1=CC=C(C=C1)C2C(=NOC2=O)C3=CC=CC=C3 |
| InChI | InChI=1S/C15H11NO2/c17-15-13(11-7-3-1-4-8-11)14(16-18-15)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | WZVWGMPHAQTGPO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 338 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|