C22H30N2O2 — CID 118422190
5-cyclopropyl-4-[2-[(2S)-5-ethylpyrrolidin-2-yl]ethoxymethyl]-3-(2-methylphenyl)-1,2-oxazole (PubChem CID 118422190) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 5-cyclopropyl-4-[2-[(2S)-5-ethylpyrrolidin-2-yl]ethoxymethyl]-3-(2-methylphenyl)-1,2-oxazole.
| Compound Name | 5-cyclopropyl-4-[2-[(2S)-5-ethylpyrrolidin-2-yl]ethoxymethyl]-3-(2-methylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 118422190 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 5-cyclopropyl-4-[2-[(2S)-5-ethylpyrrolidin-2-yl]ethoxymethyl]-3-(2-methylphenyl)-1,2-oxazole |
| SMILES | CCC1CC[C@@H](CCOCc2c(-c3ccccc3C)noc2C2CC2)N1 |
| InChI | InChI=1S/C22H30N2O2/c1-3-17-10-11-18(23-17)12-13-25-14-20-21(19-7-5-4-6-15(19)2)24-26-22(20)16-8-9-16/h4-7,16-18,23H,3,8-14H2,1-2H3/t17?,18-/m0/s1 |
| InChIKey | XPXKNJIDPOMEGM-ZVAWYAOSSA-N |
| XLogP | 4.96 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|