C22H28F2N2O3 — CID 118422182
5-cyclopropyl-3-[2-(difluoromethoxy)phenyl]-4-[2-[(2S)-5-ethylpyrrolidin-2-yl]ethoxymethyl]-1,2-oxazole (PubChem CID 118422182) has the molecular formula C22H28F2N2O3 and a molecular weight of 406.47 g/mol. Its IUPAC name is 5-cyclopropyl-3-[2-(difluoromethoxy)phenyl]-4-[2-[(2S)-5-ethylpyrrolidin-2-yl]ethoxymethyl]-1,2-oxazole.
| Compound Name | 5-cyclopropyl-3-[2-(difluoromethoxy)phenyl]-4-[2-[(2S)-5-ethylpyrrolidin-2-yl]ethoxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 118422182 |
| Molecular Formula | C22H28F2N2O3 |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 5-cyclopropyl-3-[2-(difluoromethoxy)phenyl]-4-[2-[(2S)-5-ethylpyrrolidin-2-yl]ethoxymethyl]-1,2-oxazole |
| SMILES | CCC1CC[C@@H](CCOCc2c(-c3ccccc3OC(F)F)noc2C2CC2)N1 |
| InChI | InChI=1S/C22H28F2N2O3/c1-2-15-9-10-16(25-15)11-12-27-13-18-20(26-29-21(18)14-7-8-14)17-5-3-4-6-19(17)28-22(23)24/h3-6,14-16,22,25H,2,7-13H2,1H3/t15?,16-/m0/s1 |
| InChIKey | OSPQCCUPFRRPCB-LYKKTTPLSA-N |
| XLogP | 5.26 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|