C10H12N4O — CID 118424269
3-(diaminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 118424269) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-(diaminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(diaminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 118424269 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-(diaminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)c(C(N)N)cnc12 |
| InChI | InChI=1S/C10H12N4O/c1-6-3-2-4-14-9(6)13-5-7(8(11)12)10(14)15/h2-5,8H,11-12H2,1H3 |
| InChIKey | VKLXIXCDDFBGHQ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|