C14H17N3O2 — CID 46364466
N-butyl-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 46364466) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-butyl-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | N-butyl-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 46364466 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-butyl-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCCCNC(=O)c1cnc2c(C)cccn2c1=O |
| InChI | InChI=1S/C14H17N3O2/c1-3-4-7-15-13(18)11-9-16-12-10(2)6-5-8-17(12)14(11)19/h5-6,8-9H,3-4,7H2,1-2H3,(H,15,18) |
| InChIKey | PZHZNRZPFPZBDC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|