C23H25N6O2+ — CID 2010698
6-amino-N-butyl-11-methyl-2-oxo-7-(pyridin-4-ylmethyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide (PubChem CID 2010698) has the molecular formula C23H25N6O2+ and a molecular weight of 417.49 g/mol. Its IUPAC name is 6-amino-N-butyl-11-methyl-2-oxo-7-(pyridin-4-ylmethyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide.
| Compound Name | 6-amino-N-butyl-11-methyl-2-oxo-7-(pyridin-4-ylmethyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 2010698 |
| Molecular Formula | C23H25N6O2+ |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 6-amino-N-butyl-11-methyl-2-oxo-7-(pyridin-4-ylmethyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
| SMILES | CCCCNC(=O)c1cc2c(=O)n3cccc(C)c3nc2[n+](Cc2ccncc2)c1N |
| InChI | InChI=1S/C23H24N6O2/c1-3-4-9-26-22(30)17-13-18-21(27-20-15(2)6-5-12-28(20)23(18)31)29(19(17)24)14-16-7-10-25-11-8-16/h5-8,10-13,24H,3-4,9,14H2,1-2H3,(H,26,30)/p+1 |
| InChIKey | PPNHVIXAOOLGLO-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|