C24H24N5O4+ — CID 2001013
6-amino-N-(1,3-benzodioxol-5-ylmethyl)-11-methyl-2-oxo-7-propyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide (PubChem CID 2001013) has the molecular formula C24H24N5O4+ and a molecular weight of 446.49 g/mol. Its IUPAC name is 6-amino-N-(1,3-benzodioxol-5-ylmethyl)-11-methyl-2-oxo-7-propyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide.
| Compound Name | 6-amino-N-(1,3-benzodioxol-5-ylmethyl)-11-methyl-2-oxo-7-propyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 2001013 |
| Molecular Formula | C24H24N5O4+ |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 6-amino-N-(1,3-benzodioxol-5-ylmethyl)-11-methyl-2-oxo-7-propyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
| SMILES | CCC[n+]1c(N)c(C(=O)NCc2ccc3c(c2)OCO3)cc2c(=O)n3cccc(C)c3nc21 |
| InChI | InChI=1S/C24H23N5O4/c1-3-8-28-20(25)16(23(30)26-12-15-6-7-18-19(10-15)33-13-32-18)11-17-22(28)27-21-14(2)5-4-9-29(21)24(17)31/h4-7,9-11,25H,3,8,12-13H2,1-2H3,(H,26,30)/p+1 |
| InChIKey | IRFNUUFXOSNMJP-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|