C16H18N5OS+ — CID 3321594
6-amino-11-methyl-2-oxo-7-propyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carbothioamide (PubChem CID 3321594) has the molecular formula C16H18N5OS+ and a molecular weight of 328.42 g/mol. Its IUPAC name is 6-amino-11-methyl-2-oxo-7-propyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carbothioamide.
| Compound Name | 6-amino-11-methyl-2-oxo-7-propyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carbothioamide |
|---|---|
| PubChem CID | 3321594 |
| Molecular Formula | C16H18N5OS+ |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 6-amino-11-methyl-2-oxo-7-propyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carbothioamide |
| SMILES | CCC[n+]1c(N)c(C(N)=S)cc2c(=O)n3cccc(C)c3nc21 |
| InChI | InChI=1S/C16H17N5OS/c1-3-6-20-12(17)10(13(18)23)8-11-15(20)19-14-9(2)5-4-7-21(14)16(11)22/h4-5,7-8,17H,3,6H2,1-2H3,(H2,18,23)/p+1 |
| InChIKey | ORUXGDDGIVYMTO-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|