C19H23N4O3+ — CID 6963839
ethyl 6-amino-7-[(2S)-butan-2-yl]-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate (PubChem CID 6963839) has the molecular formula C19H23N4O3+ and a molecular weight of 355.42 g/mol. Its IUPAC name is ethyl 6-amino-7-[(2S)-butan-2-yl]-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate.
| Compound Name | ethyl 6-amino-7-[(2S)-butan-2-yl]-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 6963839 |
| Molecular Formula | C19H23N4O3+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | ethyl 6-amino-7-[(2S)-butan-2-yl]-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2[n+]([C@@H](C)CC)c1N |
| InChI | InChI=1S/C19H22N4O3/c1-5-12(4)23-15(20)13(19(25)26-6-2)10-14-17(23)21-16-11(3)8-7-9-22(16)18(14)24/h7-10,12,20H,5-6H2,1-4H3/p+1/t12-/m0/s1 |
| InChIKey | ROFHMABAQPCCMX-LBPRGKRZSA-O |
| XLogP | 2.17 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|