C21H19N4O3+ — CID 5239933
methyl 6-amino-7-benzyl-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate (PubChem CID 5239933) has the molecular formula C21H19N4O3+ and a molecular weight of 375.41 g/mol. Its IUPAC name is methyl 6-amino-7-benzyl-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate.
| Compound Name | methyl 6-amino-7-benzyl-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 5239933 |
| Molecular Formula | C21H19N4O3+ |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl 6-amino-7-benzyl-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxylate |
| SMILES | COC(=O)c1cc2c(=O)n3cccc(C)c3nc2[n+](Cc2ccccc2)c1N |
| InChI | InChI=1S/C21H18N4O3/c1-13-7-6-10-24-18(13)23-19-16(20(24)26)11-15(21(27)28-2)17(22)25(19)12-14-8-4-3-5-9-14/h3-11,22H,12H2,1-2H3/p+1 |
| InChIKey | VEJHQDIYCRWMTB-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|