C25H21ClN5O3+ — CID 2008365
6-amino-N-[(2-chlorophenyl)methyl]-7-(furan-2-ylmethyl)-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide (PubChem CID 2008365) has the molecular formula C25H21ClN5O3+ and a molecular weight of 474.93 g/mol. Its IUPAC name is 6-amino-N-[(2-chlorophenyl)methyl]-7-(furan-2-ylmethyl)-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide.
| Compound Name | 6-amino-N-[(2-chlorophenyl)methyl]-7-(furan-2-ylmethyl)-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 2008365 |
| Molecular Formula | C25H21ClN5O3+ |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 6-amino-N-[(2-chlorophenyl)methyl]-7-(furan-2-ylmethyl)-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaene-5-carboxamide |
| SMILES | Cc1cccn2c(=O)c3cc(C(=O)NCc4ccccc4Cl)c(N)[n+](Cc4ccco4)c3nc12 |
| InChI | InChI=1S/C25H20ClN5O3/c1-15-6-4-10-30-22(15)29-23-19(25(30)33)12-18(21(27)31(23)14-17-8-5-11-34-17)24(32)28-13-16-7-2-3-9-20(16)26/h2-12,27H,13-14H2,1H3,(H,28,32)/p+1 |
| InChIKey | NUQDKDMFUKOQKC-UHFFFAOYSA-O |
| XLogP | 3.25 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|