C27H26ClN3O5 — CID 118424609
(3R,3aS,6S,6aS)-6-[[6-chloro-5-[4-[4-(2-hydroxypropan-2-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118424609) has the molecular formula C27H26ClN3O5 and a molecular weight of 507.97 g/mol. Its IUPAC name is (3R,3aS,6S,6aS)-6-[[6-chloro-5-[4-[4-(2-hydroxypropan-2-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aS,6S,6aS)-6-[[6-chloro-5-[4-[4-(2-hydroxypropan-2-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118424609 |
| Molecular Formula | C27H26ClN3O5 |
| Molecular Weight | 507.97 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (3R,3aS,6S,6aS)-6-[[6-chloro-5-[4-[4-(2-hydroxypropan-2-yl)phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CC(C)(O)c1ccc(-c2ccc(-c3nc4nc(O[C@H]5CO[C@@H]6[C@H]5OC[C@H]6O)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C27H26ClN3O5/c1-27(2,33)17-9-7-15(8-10-17)14-3-5-16(6-4-14)22-18(28)11-19-25(30-22)31-26(29-19)36-21-13-35-23-20(32)12-34-24(21)23/h3-11,20-21,23-24,32-33H,12-13H2,1-2H3,(H,29,30,31)/t20-,21+,23+,24+/m1/s1 |
| InChIKey | OTEYWLUXKLVSSM-KJBBBAAKSA-N |
| XLogP | 4.08 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.97 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |