C24H19Cl2N3O4 — CID 90067556
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(4-chlorophenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 90067556) has the molecular formula C24H19Cl2N3O4 and a molecular weight of 484.34 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(4-chlorophenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(4-chlorophenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 90067556 |
| Molecular Formula | C24H19Cl2N3O4 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(4-chlorophenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(-c3ccc(-c4ccc(Cl)cc4)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C24H19Cl2N3O4/c25-15-7-5-13(6-8-15)12-1-3-14(4-2-12)20-16(26)9-17-23(28-20)29-24(27-17)33-19-11-32-21-18(30)10-31-22(19)21/h1-9,18-19,21-22,30H,10-11H2,(H,27,28,29)/t18-,19-,21-,22-/m1/s1 |
| InChIKey | KPAGKTAHYLAHSC-UGESXGAOSA-N |
| XLogP | 4.50 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |