C27H36NO7P — CID 118426468
tert-butyl 3-[bis[2-(4-acetylphenoxy)ethyl]phosphorylamino]propanoate (PubChem CID 118426468) has the molecular formula C27H36NO7P and a molecular weight of 517.56 g/mol. Its IUPAC name is tert-butyl 3-[bis[2-(4-acetylphenoxy)ethyl]phosphorylamino]propanoate.
| Compound Name | tert-butyl 3-[bis[2-(4-acetylphenoxy)ethyl]phosphorylamino]propanoate |
|---|---|
| PubChem CID | 118426468 |
| Molecular Formula | C27H36NO7P |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | tert-butyl 3-[bis[2-(4-acetylphenoxy)ethyl]phosphorylamino]propanoate |
| SMILES | CC(=O)c1ccc(OCCP(=O)(CCOc2ccc(C(C)=O)cc2)NCCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H36NO7P/c1-20(29)22-6-10-24(11-7-22)33-16-18-36(32,28-15-14-26(31)35-27(3,4)5)19-17-34-25-12-8-23(9-13-25)21(2)30/h6-13H,14-19H2,1-5H3,(H,28,32) |
| InChIKey | YWDKCYVBKOFCFK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|