About 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one
8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one (PubChem CID 118426615) has the molecular formula C21H12F3N5O2
and a molecular weight of 423.35 g/mol. Its IUPAC name is 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one.
Molecular Properties
| Compound Name | 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one |
| PubChem CID | 118426615 |
| Molecular Formula | C21H12F3N5O2 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one |
| SMILES | O=c1c2nccnc2c(-c2ccc3nccn3c2)cn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H12F3N5O2/c22-21(23,24)31-15-4-2-14(3-5-15)29-12-16(18-19(20(29)30)27-8-7-26-18)13-1-6-17-25-9-10-28(17)11-13/h1-12H |
| InChIKey | KDLCAGXMPCRLDY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one?
The IUPAC name of 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one (CID 118426615) is 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one.
What is the SMILES notation for 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one?
The canonical SMILES for 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one is O=c1c2nccnc2c(-c2ccc3nccn3c2)cn1-c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one?
The InChIKey is KDLCAGXMPCRLDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12F3N5O2/c22-21(23,24)31-15-4-2-14(3-5-15)29-12-16(18-19(20(29)30)27-8-7-26-18)13-1-6-17-25-9-10-28(17)11-13/h1-12H.
What are the key properties of 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one?
8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one has a molecular weight of 423.35 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-imidazo[1,2-a]pyridin-6-yl-6-[4-(trifluoromethoxy)phenyl]pyrido[3,4-b]pyrazin-5-one is sourced from PubChem (CID 118426615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).