C57H51N — CID 118428468
9,9-ditert-butyl-N,N,7-tris(4-phenylphenyl)fluoren-2-amine (PubChem CID 118428468) has the molecular formula C57H51N and a molecular weight of 750.04 g/mol. Its IUPAC name is 9,9-ditert-butyl-N,N,7-tris(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 9,9-ditert-butyl-N,N,7-tris(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 118428468 |
| Molecular Formula | C57H51N |
| Molecular Weight | 750.04 g/mol |
| Exact Mass | 749.40 |
| IUPAC Name | 9,9-ditert-butyl-N,N,7-tris(4-phenylphenyl)fluoren-2-amine |
| SMILES | CC(C)(C)C1(C(C)(C)C)c2cc(-c3ccc(-c4ccccc4)cc3)ccc2-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C57H51N/c1-55(2,3)57(56(4,5)6)53-38-47(46-24-22-43(23-25-46)40-16-10-7-11-17-40)30-36-51(53)52-37-35-50(39-54(52)57)58(48-31-26-44(27-32-48)41-18-12-8-13-19-41)49-33-28-45(29-34-49)42-20-14-9-15-21-42/h7-39H,1-6H3 |
| InChIKey | LNOGVBNVOBDJPR-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.04 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |