C20H25N5O3 — CID 118428784
1-[3-[5-[2-[2-(2-hydroxyethoxy)ethylamino]ethylamino]pyrazolo[1,5-a]pyrimidin-3-yl]phenyl]ethanone (PubChem CID 118428784) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[3-[5-[2-[2-(2-hydroxyethoxy)ethylamino]ethylamino]pyrazolo[1,5-a]pyrimidin-3-yl]phenyl]ethanone.
| Compound Name | 1-[3-[5-[2-[2-(2-hydroxyethoxy)ethylamino]ethylamino]pyrazolo[1,5-a]pyrimidin-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 118428784 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-[3-[5-[2-[2-(2-hydroxyethoxy)ethylamino]ethylamino]pyrazolo[1,5-a]pyrimidin-3-yl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2cnn3ccc(NCCNCCOCCO)nc23)c1 |
| InChI | InChI=1S/C20H25N5O3/c1-15(27)16-3-2-4-17(13-16)18-14-23-25-9-5-19(24-20(18)25)22-7-6-21-8-11-28-12-10-26/h2-5,9,13-14,21,26H,6-8,10-12H2,1H3,(H,22,24) |
| InChIKey | DCKUQRHVYPUFLK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|