C24H24N4O4 — CID 177044933
methyl 4-[7-[2-(2-hydroxyethoxy)ethylamino]-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl]benzoate (PubChem CID 177044933) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl 4-[7-[2-(2-hydroxyethoxy)ethylamino]-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl]benzoate.
| Compound Name | methyl 4-[7-[2-(2-hydroxyethoxy)ethylamino]-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl]benzoate |
|---|---|
| PubChem CID | 177044933 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | methyl 4-[7-[2-(2-hydroxyethoxy)ethylamino]-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cnn3c(NCCOCCO)cc(-c4ccccc4)nc23)cc1 |
| InChI | InChI=1S/C24H24N4O4/c1-31-24(30)19-9-7-17(8-10-19)20-16-26-28-22(25-11-13-32-14-12-29)15-21(27-23(20)28)18-5-3-2-4-6-18/h2-10,15-16,25,29H,11-14H2,1H3 |
| InChIKey | LCXJQOLFYHMMOA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|