C23H25N5O4S — CID 177044986
N-[2-[7-[2-(2-hydroxyethoxy)ethylamino]-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl]phenyl]methanesulfonamide (PubChem CID 177044986) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[2-[7-[2-(2-hydroxyethoxy)ethylamino]-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[7-[2-(2-hydroxyethoxy)ethylamino]-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 177044986 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-[2-[7-[2-(2-hydroxyethoxy)ethylamino]-5-phenylpyrazolo[1,5-a]pyrimidin-3-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1-c1cnn2c(NCCOCCO)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C23H25N5O4S/c1-33(30,31)27-20-10-6-5-9-18(20)19-16-25-28-22(24-11-13-32-14-12-29)15-21(26-23(19)28)17-7-3-2-4-8-17/h2-10,15-16,24,27,29H,11-14H2,1H3 |
| InChIKey | XLHWTPPLRLHXAF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|