C23H21F3N4O2 — CID 177044949
2-[2-[[5-phenyl-3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethoxy]ethanol (PubChem CID 177044949) has the molecular formula C23H21F3N4O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 2-[2-[[5-phenyl-3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[5-phenyl-3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 177044949 |
| Molecular Formula | C23H21F3N4O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[2-[[5-phenyl-3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1cc(-c2ccccc2)nc2c(-c3ccc(C(F)(F)F)cc3)cnn12 |
| InChI | InChI=1S/C23H21F3N4O2/c24-23(25,26)18-8-6-16(7-9-18)19-15-28-30-21(27-10-12-32-13-11-31)14-20(29-22(19)30)17-4-2-1-3-5-17/h1-9,14-15,27,31H,10-13H2 |
| InChIKey | WGQRNUIHYFZWDY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|